About [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate
[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate (PubChem CID 55998120) has the molecular formula C19H11ClFN3O3
and a molecular weight of 383.77 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate.
Molecular Properties
| Compound Name | [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate |
| PubChem CID | 55998120 |
| Molecular Formula | C19H11ClFN3O3 |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate |
| SMILES | O=C(OCc1noc(-c2ccc(F)cc2)n1)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C19H11ClFN3O3/c20-16-8-4-12-9-13(3-7-15(12)22-16)19(25)26-10-17-23-18(27-24-17)11-1-5-14(21)6-2-11/h1-9H,10H2 |
| InChIKey | XWGYFGVUWUJANY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate?
The IUPAC name of [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate (CID 55998120) is [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate.
What is the SMILES notation for [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate?
The canonical SMILES for [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate is O=C(OCc1noc(-c2ccc(F)cc2)n1)c1ccc2nc(Cl)ccc2c1.
What is the InChIKey of [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate?
The InChIKey is XWGYFGVUWUJANY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClFN3O3/c20-16-8-4-12-9-13(3-7-15(12)22-16)19(25)26-10-17-23-18(27-24-17)11-1-5-14(21)6-2-11/h1-9H,10H2.
What are the key properties of [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate?
[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate has a molecular weight of 383.77 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl 2-chloroquinoline-6-carboxylate is sourced from PubChem (CID 55998120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).