C17H17ClN2O4 — CID 55998394
[2-(2-methylmorpholin-4-yl)-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55998394) has the molecular formula C17H17ClN2O4 and a molecular weight of 348.79 g/mol. Its IUPAC name is [2-(2-methylmorpholin-4-yl)-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-(2-methylmorpholin-4-yl)-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55998394 |
| Molecular Formula | C17H17ClN2O4 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [2-(2-methylmorpholin-4-yl)-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | CC1CN(C(=O)COC(=O)c2ccc3nc(Cl)ccc3c2)CCO1 |
| InChI | InChI=1S/C17H17ClN2O4/c1-11-9-20(6-7-23-11)16(21)10-24-17(22)13-2-4-14-12(8-13)3-5-15(18)19-14/h2-5,8,11H,6-7,9-10H2,1H3 |
| InChIKey | YQNRBEJPDAVAFB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|