About [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate (PubChem CID 55998632) has the molecular formula C13H20N2O5
and a molecular weight of 284.31 g/mol. Its IUPAC name is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate |
| PubChem CID | 55998632 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate |
| SMILES | CC1CC(C)CN(C(=O)COC(=O)C2CC2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H20N2O5/c1-8-3-9(2)6-14(5-8)12(16)7-20-13(17)10-4-11(10)15(18)19/h8-11H,3-7H2,1-2H3 |
| InChIKey | XGHBNUMCSASDMR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate?
The IUPAC name of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate (CID 55998632) is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate.
What is the SMILES notation for [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate?
The canonical SMILES for [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate is CC1CC(C)CN(C(=O)COC(=O)C2CC2[N+](=O)[O-])C1.
What is the InChIKey of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate?
The InChIKey is XGHBNUMCSASDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O5/c1-8-3-9(2)6-14(5-8)12(16)7-20-13(17)10-4-11(10)15(18)19/h8-11H,3-7H2,1-2H3.
What are the key properties of [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate?
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate has a molecular weight of 284.31 g/mol, XLogP of 0.70, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate is sourced from PubChem (CID 55998632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).