C22H19ClN4O4S — CID 55998900
[2-oxo-2-[propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]amino]ethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55998900) has the molecular formula C22H19ClN4O4S and a molecular weight of 470.94 g/mol. Its IUPAC name is [2-oxo-2-[propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]amino]ethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-oxo-2-[propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]amino]ethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55998900 |
| Molecular Formula | C22H19ClN4O4S |
| Molecular Weight | 470.94 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | [2-oxo-2-[propyl-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)methyl]amino]ethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | CCCN(Cc1nnc(-c2cccs2)o1)C(=O)COC(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C22H19ClN4O4S/c1-2-9-27(12-19-25-26-21(31-19)17-4-3-10-32-17)20(28)13-30-22(29)15-5-7-16-14(11-15)6-8-18(23)24-16/h3-8,10-11H,2,9,12-13H2,1H3 |
| InChIKey | VXNDZLQFWMLHKU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.94 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|