C20H16ClFN2O3 — CID 55999459
[2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate (PubChem CID 55999459) has the molecular formula C20H16ClFN2O3 and a molecular weight of 386.81 g/mol. Its IUPAC name is [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate.
| Compound Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 55999459 |
| Molecular Formula | C20H16ClFN2O3 |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-[(3-fluorophenyl)methyl-methylamino]-2-oxoethyl] 2-chloroquinoline-6-carboxylate |
| SMILES | CN(Cc1cccc(F)c1)C(=O)COC(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C20H16ClFN2O3/c1-24(11-13-3-2-4-16(22)9-13)19(25)12-27-20(26)15-5-7-17-14(10-15)6-8-18(21)23-17/h2-10H,11-12H2,1H3 |
| InChIKey | BUXQVHYADDIAQR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|