C8H5F3O2S — CID 5601
4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione (PubChem CID 5601) has the molecular formula C8H5F3O2S and a molecular weight of 222.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 5601 |
| Molecular Formula | C8H5F3O2S |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C8H5F3O2S/c9-8(10,11)7(13)4-5(12)6-2-1-3-14-6/h1-3H,4H2 |
| InChIKey | TXBBUSUXYMIVOS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|