About 2-heptyl-4-methyl-1,3-dioxolane
2-heptyl-4-methyl-1,3-dioxolane (PubChem CID 560109) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-heptyl-4-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-heptyl-4-methyl-1,3-dioxolane |
| PubChem CID | 560109 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-heptyl-4-methyl-1,3-dioxolane |
| SMILES | CCCCCCCC1OCC(C)O1 |
| InChI | InChI=1S/C11H22O2/c1-3-4-5-6-7-8-11-12-9-10(2)13-11/h10-11H,3-9H2,1-2H3 |
| InChIKey | PTJICCHLTNPHDB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-heptyl-4-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptyl-4-methyl-1,3-dioxolane?
The IUPAC name of 2-heptyl-4-methyl-1,3-dioxolane (CID 560109) is 2-heptyl-4-methyl-1,3-dioxolane.
What is the SMILES notation for 2-heptyl-4-methyl-1,3-dioxolane?
The canonical SMILES for 2-heptyl-4-methyl-1,3-dioxolane is CCCCCCCC1OCC(C)O1.
What is the InChIKey of 2-heptyl-4-methyl-1,3-dioxolane?
The InChIKey is PTJICCHLTNPHDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-3-4-5-6-7-8-11-12-9-10(2)13-11/h10-11H,3-9H2,1-2H3.
What are the key properties of 2-heptyl-4-methyl-1,3-dioxolane?
2-heptyl-4-methyl-1,3-dioxolane has a molecular weight of 186.29 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptyl-4-methyl-1,3-dioxolane is sourced from PubChem (CID 560109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).