About 2-butan-2-yl-1,1-diethylhydrazine
2-butan-2-yl-1,1-diethylhydrazine (PubChem CID 560118) has the molecular formula C8H20N2
and a molecular weight of 144.26 g/mol. Its IUPAC name is 2-butan-2-yl-1,1-diethylhydrazine.
Molecular Properties
| Compound Name | 2-butan-2-yl-1,1-diethylhydrazine |
| PubChem CID | 560118 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | 2-butan-2-yl-1,1-diethylhydrazine |
| SMILES | CCC(C)NN(CC)CC |
| InChI | InChI=1S/C8H20N2/c1-5-8(4)9-10(6-2)7-3/h8-9H,5-7H2,1-4H3 |
| InChIKey | WFQSIAIFBOBSOD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yl-1,1-diethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-1,1-diethylhydrazine?
The IUPAC name of 2-butan-2-yl-1,1-diethylhydrazine (CID 560118) is 2-butan-2-yl-1,1-diethylhydrazine.
What is the SMILES notation for 2-butan-2-yl-1,1-diethylhydrazine?
The canonical SMILES for 2-butan-2-yl-1,1-diethylhydrazine is CCC(C)NN(CC)CC.
What is the InChIKey of 2-butan-2-yl-1,1-diethylhydrazine?
The InChIKey is WFQSIAIFBOBSOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2/c1-5-8(4)9-10(6-2)7-3/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-butan-2-yl-1,1-diethylhydrazine?
2-butan-2-yl-1,1-diethylhydrazine has a molecular weight of 144.26 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1,1-diethylhydrazine is sourced from PubChem (CID 560118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).