About N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide
N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide (PubChem CID 560205) has the molecular formula C13H25NO6
and a molecular weight of 291.34 g/mol. Its IUPAC name is N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide |
| PubChem CID | 560205 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide |
| SMILES | COCC1OC(OC)C(N(C)C(C)=O)C(OC)C1OC |
| InChI | InChI=1S/C13H25NO6/c1-8(15)14(2)10-12(18-5)11(17-4)9(7-16-3)20-13(10)19-6/h9-13H,7H2,1-6H3 |
| InChIKey | LLBFFWSIFJDSHK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide?
The IUPAC name of N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide (CID 560205) is N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide.
What is the SMILES notation for N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide?
The canonical SMILES for N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide is COCC1OC(OC)C(N(C)C(C)=O)C(OC)C1OC.
What is the InChIKey of N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide?
The InChIKey is LLBFFWSIFJDSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO6/c1-8(15)14(2)10-12(18-5)11(17-4)9(7-16-3)20-13(10)19-6/h9-13H,7H2,1-6H3.
What are the key properties of N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide?
N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide has a molecular weight of 291.34 g/mol, XLogP of -0.12, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[2,4,5-trimethoxy-6-(methoxymethyl)oxan-3-yl]acetamide is sourced from PubChem (CID 560205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).