C32H64O11 — CID 560228
2-(3,7,9,11,12,13-hexamethoxy-2,4,8,10-tetramethyltridecan-5-yl)oxy-3,4,5-trimethoxy-6-methyloxane (PubChem CID 560228) has the molecular formula C32H64O11 and a molecular weight of 624.85 g/mol. Its IUPAC name is 2-(3,7,9,11,12,13-hexamethoxy-2,4,8,10-tetramethyltridecan-5-yl)oxy-3,4,5-trimethoxy-6-methyloxane.
| Compound Name | 2-(3,7,9,11,12,13-hexamethoxy-2,4,8,10-tetramethyltridecan-5-yl)oxy-3,4,5-trimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 560228 |
| Molecular Formula | C32H64O11 |
| Molecular Weight | 624.85 g/mol |
| Exact Mass | 624.44 |
| IUPAC Name | 2-(3,7,9,11,12,13-hexamethoxy-2,4,8,10-tetramethyltridecan-5-yl)oxy-3,4,5-trimethoxy-6-methyloxane |
| SMILES | COCC(OC)C(OC)C(C)C(OC)C(C)C(CC(OC1OC(C)C(OC)C(OC)C1OC)C(C)C(OC)C(C)C)OC |
| InChI | InChI=1S/C32H64O11/c1-18(2)26(36-10)20(4)24(43-32-31(41-15)30(40-14)29(39-13)22(6)42-32)16-23(34-8)19(3)27(37-11)21(5)28(38-12)25(35-9)17-33-7/h18-32H,16-17H2,1-15H3 |
| InChIKey | OLFNXEWKUWAKMJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 101.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |