About ethyl 3-methylpentanoate
ethyl 3-methylpentanoate (PubChem CID 560255) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is ethyl 3-methylpentanoate.
Molecular Properties
| Compound Name | ethyl 3-methylpentanoate |
| PubChem CID | 560255 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | ethyl 3-methylpentanoate |
| SMILES | CCOC(=O)CC(C)CC |
| InChI | InChI=1S/C8H16O2/c1-4-7(3)6-8(9)10-5-2/h7H,4-6H2,1-3H3 |
| InChIKey | TXAWGHYFBQBVNK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methylpentanoate?
The IUPAC name of ethyl 3-methylpentanoate (CID 560255) is ethyl 3-methylpentanoate.
What is the SMILES notation for ethyl 3-methylpentanoate?
The canonical SMILES for ethyl 3-methylpentanoate is CCOC(=O)CC(C)CC.
What is the InChIKey of ethyl 3-methylpentanoate?
The InChIKey is TXAWGHYFBQBVNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-4-7(3)6-8(9)10-5-2/h7H,4-6H2,1-3H3.
What are the key properties of ethyl 3-methylpentanoate?
ethyl 3-methylpentanoate has a molecular weight of 144.21 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methylpentanoate is sourced from PubChem (CID 560255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).