About heptan-2-amine
heptan-2-amine (PubChem CID 5603) has the molecular formula C7H17N
and a molecular weight of 115.22 g/mol. Its IUPAC name is heptan-2-amine.
Molecular Properties
| Compound Name | heptan-2-amine |
| PubChem CID | 5603 |
| Molecular Formula | C7H17N |
| Molecular Weight | 115.22 g/mol |
| Exact Mass | 115.14 |
| IUPAC Name | heptan-2-amine |
| SMILES | CCCCCC(C)N |
| InChI | InChI=1S/C7H17N/c1-3-4-5-6-7(2)8/h7H,3-6,8H2,1-2H3 |
| InChIKey | VSRBKQFNFZQRBM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-amine?
The IUPAC name of heptan-2-amine (CID 5603) is heptan-2-amine.
What is the SMILES notation for heptan-2-amine?
The canonical SMILES for heptan-2-amine is CCCCCC(C)N.
What is the InChIKey of heptan-2-amine?
The InChIKey is VSRBKQFNFZQRBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N/c1-3-4-5-6-7(2)8/h7H,3-6,8H2,1-2H3.
What are the key properties of heptan-2-amine?
heptan-2-amine has a molecular weight of 115.22 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-amine is sourced from PubChem (CID 5603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).