C29H54O16 — CID 560353
3-[3,4-dimethoxy-6-(methoxymethyl)-5-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,4,5,6-tetramethoxyhexanal (PubChem CID 560353) has the molecular formula C29H54O16 and a molecular weight of 658.73 g/mol. Its IUPAC name is 3-[3,4-dimethoxy-6-(methoxymethyl)-5-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,4,5,6-tetramethoxyhexanal.
| Compound Name | 3-[3,4-dimethoxy-6-(methoxymethyl)-5-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,4,5,6-tetramethoxyhexanal |
|---|---|
| PubChem CID | 560353 |
| Molecular Formula | C29H54O16 |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | 3-[3,4-dimethoxy-6-(methoxymethyl)-5-[3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,4,5,6-tetramethoxyhexanal |
| SMILES | COCC(OC)C(OC)C(OC1OC(COC)C(OC2OC(COC)C(OC)C(OC)C2OC)C(OC)C1OC)C(C=O)OC |
| InChI | InChI=1S/C29H54O16/c1-31-13-17(35-5)20(36-6)22(16(12-30)34-4)44-29-27(41-11)25(39-9)23(19(43-29)15-33-3)45-28-26(40-10)24(38-8)21(37-7)18(42-28)14-32-2/h12,16-29H,13-15H2,1-11H3 |
| InChIKey | IMCZVNUZPZRBMS-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 155.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|