C23H38O6 — CID 560606
5-(2-methoxyethoxymethoxy)-5',7-dimethyl-2'-propan-2-ylspiro[8,10-dioxatricyclo[5.4.0.02,6]undecane-9,1'-cyclohexane]-11-one (PubChem CID 560606) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is 5-(2-methoxyethoxymethoxy)-5',7-dimethyl-2'-propan-2-ylspiro[8,10-dioxatricyclo[5.4.0.02,6]undecane-9,1'-cyclohexane]-11-one.
| Compound Name | 5-(2-methoxyethoxymethoxy)-5',7-dimethyl-2'-propan-2-ylspiro[8,10-dioxatricyclo[5.4.0.02,6]undecane-9,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 560606 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 5-(2-methoxyethoxymethoxy)-5',7-dimethyl-2'-propan-2-ylspiro[8,10-dioxatricyclo[5.4.0.02,6]undecane-9,1'-cyclohexane]-11-one |
| SMILES | COCCOCOC1CCC2C3C(=O)OC4(CC(C)CCC4C(C)C)OC3(C)C12 |
| InChI | InChI=1S/C23H38O6/c1-14(2)17-8-6-15(3)12-23(17)28-21(24)20-16-7-9-18(19(16)22(20,4)29-23)27-13-26-11-10-25-5/h14-20H,6-13H2,1-5H3 |
| InChIKey | XOUKRRUCPMXLNT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|