About 3-methoxyhexane-1,6-diol
3-methoxyhexane-1,6-diol (PubChem CID 560608) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is 3-methoxyhexane-1,6-diol.
Molecular Properties
| Compound Name | 3-methoxyhexane-1,6-diol |
| PubChem CID | 560608 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | 3-methoxyhexane-1,6-diol |
| SMILES | COC(CCO)CCCO |
| InChI | InChI=1S/C7H16O3/c1-10-7(4-6-9)3-2-5-8/h7-9H,2-6H2,1H3 |
| InChIKey | YSOPDBRLPXLQMU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxyhexane-1,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxyhexane-1,6-diol?
The IUPAC name of 3-methoxyhexane-1,6-diol (CID 560608) is 3-methoxyhexane-1,6-diol.
What is the SMILES notation for 3-methoxyhexane-1,6-diol?
The canonical SMILES for 3-methoxyhexane-1,6-diol is COC(CCO)CCCO.
What is the InChIKey of 3-methoxyhexane-1,6-diol?
The InChIKey is YSOPDBRLPXLQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O3/c1-10-7(4-6-9)3-2-5-8/h7-9H,2-6H2,1H3.
What are the key properties of 3-methoxyhexane-1,6-diol?
3-methoxyhexane-1,6-diol has a molecular weight of 148.20 g/mol, XLogP of 0.16, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxyhexane-1,6-diol is sourced from PubChem (CID 560608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).