About 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane
2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 560695) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane |
| PubChem CID | 560695 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | COC1C2COC(O2)C(OC)C1OC |
| InChI | InChI=1S/C9H16O5/c1-10-6-5-4-13-9(14-5)8(12-3)7(6)11-2/h5-9H,4H2,1-3H3 |
| InChIKey | ZZSLTIGBKYUBSG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane?
The IUPAC name of 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane (CID 560695) is 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane.
What is the SMILES notation for 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane?
The canonical SMILES for 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane is COC1C2COC(O2)C(OC)C1OC.
What is the InChIKey of 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane?
The InChIKey is ZZSLTIGBKYUBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-10-6-5-4-13-9(14-5)8(12-3)7(6)11-2/h5-9H,4H2,1-3H3.
What are the key properties of 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane?
2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane has a molecular weight of 204.22 g/mol, XLogP of -0.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4-trimethoxy-6,8-dioxabicyclo[3.2.1]octane is sourced from PubChem (CID 560695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).