About 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide
2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 560765) has the molecular formula C11H9BrN2OS
and a molecular weight of 297.18 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 560765 |
| Molecular Formula | C11H9BrN2OS |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | NC(=O)Cc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C11H9BrN2OS/c12-8-3-1-7(2-4-8)9-6-16-11(14-9)5-10(13)15/h1-4,6H,5H2,(H2,13,15) |
| InChIKey | RLOFEQQGBMPQSA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide (CID 560765) is 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide is NC(=O)Cc1nc(-c2ccc(Br)cc2)cs1.
What is the InChIKey of 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is RLOFEQQGBMPQSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2OS/c12-8-3-1-7(2-4-8)9-6-16-11(14-9)5-10(13)15/h1-4,6H,5H2,(H2,13,15).
What are the key properties of 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide?
2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 297.18 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 560765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).