C19H23NO3S2 — CID 560768
2-ethylsulfanylethyl 2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 560768) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl 2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 560768 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-ethylsulfanylethyl 2-methyl-5-oxo-4-thiophen-2-yl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCSCCOC(=O)C1=C(C)NC2=C(C(=O)CCC2)C1c1cccs1 |
| InChI | InChI=1S/C19H23NO3S2/c1-3-24-11-9-23-19(22)16-12(2)20-13-6-4-7-14(21)17(13)18(16)15-8-5-10-25-15/h5,8,10,18,20H,3-4,6-7,9,11H2,1-2H3 |
| InChIKey | XBFNONSWWYZTPX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|