About 2-diazoadamantane
2-diazoadamantane (PubChem CID 560893) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-diazoadamantane.
Molecular Properties
| Compound Name | 2-diazoadamantane |
| PubChem CID | 560893 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-diazoadamantane |
| SMILES | [N-]=[N+]=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C10H14N2/c11-12-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2 |
| InChIKey | YLUADXJKFSVCDQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazoadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazoadamantane?
The IUPAC name of 2-diazoadamantane (CID 560893) is 2-diazoadamantane.
What is the SMILES notation for 2-diazoadamantane?
The canonical SMILES for 2-diazoadamantane is [N-]=[N+]=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-diazoadamantane?
The InChIKey is YLUADXJKFSVCDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c11-12-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2.
What are the key properties of 2-diazoadamantane?
2-diazoadamantane has a molecular weight of 162.24 g/mol, XLogP of 2.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazoadamantane is sourced from PubChem (CID 560893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).