About 5-methylhepta-1,6-dien-3-yne
5-methylhepta-1,6-dien-3-yne (PubChem CID 560894) has the molecular formula C8H10
and a molecular weight of 106.17 g/mol. Its IUPAC name is 5-methylhepta-1,6-dien-3-yne.
Molecular Properties
| Compound Name | 5-methylhepta-1,6-dien-3-yne |
| PubChem CID | 560894 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | 5-methylhepta-1,6-dien-3-yne |
| SMILES | C=CC#CC(C)C=C |
| InChI | InChI=1S/C8H10/c1-4-6-7-8(3)5-2/h4-5,8H,1-2H2,3H3 |
| InChIKey | MKOTWHSKXYVPOM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhepta-1,6-dien-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhepta-1,6-dien-3-yne?
The IUPAC name of 5-methylhepta-1,6-dien-3-yne (CID 560894) is 5-methylhepta-1,6-dien-3-yne.
What is the SMILES notation for 5-methylhepta-1,6-dien-3-yne?
The canonical SMILES for 5-methylhepta-1,6-dien-3-yne is C=CC#CC(C)C=C.
What is the InChIKey of 5-methylhepta-1,6-dien-3-yne?
The InChIKey is MKOTWHSKXYVPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10/c1-4-6-7-8(3)5-2/h4-5,8H,1-2H2,3H3.
What are the key properties of 5-methylhepta-1,6-dien-3-yne?
5-methylhepta-1,6-dien-3-yne has a molecular weight of 106.17 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhepta-1,6-dien-3-yne is sourced from PubChem (CID 560894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).