C19H28 — CID 560947
2-ethenyl-2,4b-dimethyl-8-methylidene-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene (PubChem CID 560947) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 2-ethenyl-2,4b-dimethyl-8-methylidene-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene.
| Compound Name | 2-ethenyl-2,4b-dimethyl-8-methylidene-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 560947 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 2-ethenyl-2,4b-dimethyl-8-methylidene-3,4,4a,5,6,7,8a,9-octahydro-1H-phenanthrene |
| SMILES | C=CC1(C)CCC2C(=CCC3C(=C)CCCC32C)C1 |
| InChI | InChI=1S/C19H28/c1-5-18(3)12-10-17-15(13-18)8-9-16-14(2)7-6-11-19(16,17)4/h5,8,16-17H,1-2,6-7,9-13H2,3-4H3 |
| InChIKey | BDOVQRGWITVTSL-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|