About [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate
[2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate (PubChem CID 561088) has the molecular formula C31H37NO5
and a molecular weight of 503.64 g/mol. Its IUPAC name is [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate.
Molecular Properties
| Compound Name | [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate |
| PubChem CID | 561088 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate |
| SMILES | CC(=O)OCC1C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1N(C)C |
| InChI | InChI=1S/C31H37NO5/c1-23(33)34-22-27-28(32(2)3)30(36-20-25-15-9-5-10-16-25)31(37-21-26-17-11-6-12-18-26)29(27)35-19-24-13-7-4-8-14-24/h4-18,27-31H,19-22H2,1-3H3 |
| InChIKey | XLNOLCYQSYZQNU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate?
The IUPAC name of [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate (CID 561088) is [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate.
What is the SMILES notation for [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate?
The canonical SMILES for [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate is CC(=O)OCC1C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1N(C)C.
What is the InChIKey of [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate?
The InChIKey is XLNOLCYQSYZQNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H37NO5/c1-23(33)34-22-27-28(32(2)3)30(36-20-25-15-9-5-10-16-25)31(37-21-26-17-11-6-12-18-26)29(27)35-19-24-13-7-4-8-14-24/h4-18,27-31H,19-22H2,1-3H3.
What are the key properties of [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate?
[2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate has a molecular weight of 503.64 g/mol, XLogP of 4.87, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)-3,4,5-tris(phenylmethoxy)cyclopentyl]methyl acetate is sourced from PubChem (CID 561088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).