C13H16O3 — CID 561127
1-phenylmethoxyhexane-3,4-dione (PubChem CID 561127) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-phenylmethoxyhexane-3,4-dione.
| Compound Name | 1-phenylmethoxyhexane-3,4-dione |
|---|---|
| PubChem CID | 561127 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 1-phenylmethoxyhexane-3,4-dione |
| SMILES | CCC(=O)C(=O)CCOCc1ccccc1 |
| InChI | InChI=1S/C13H16O3/c1-2-12(14)13(15)8-9-16-10-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3 |
| InChIKey | YMYAXMYSCSUBSG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|