C14H20O3 — CID 561179
2,2,4-trimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane (PubChem CID 561179) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2,2,4-trimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane.
| Compound Name | 2,2,4-trimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 561179 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2,2,4-trimethyl-5-(phenylmethoxymethyl)-1,3-dioxolane |
| SMILES | CC1OC(C)(C)OC1COCc1ccccc1 |
| InChI | InChI=1S/C14H20O3/c1-11-13(17-14(2,3)16-11)10-15-9-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3 |
| InChIKey | DUZGYPMPHGHLIH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |