About 2,4,5-triphenyltriazole
2,4,5-triphenyltriazole (PubChem CID 561195) has the molecular formula C20H15N3
and a molecular weight of 297.36 g/mol. Its IUPAC name is 2,4,5-triphenyltriazole.
Molecular Properties
| Compound Name | 2,4,5-triphenyltriazole |
| PubChem CID | 561195 |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2,4,5-triphenyltriazole |
| SMILES | c1ccc(-c2nn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15N3/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)22-23(21-19)18-14-8-3-9-15-18/h1-15H |
| InChIKey | IGCQUFIXBNFPGT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,5-triphenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-triphenyltriazole?
The IUPAC name of 2,4,5-triphenyltriazole (CID 561195) is 2,4,5-triphenyltriazole.
What is the SMILES notation for 2,4,5-triphenyltriazole?
The canonical SMILES for 2,4,5-triphenyltriazole is c1ccc(-c2nn(-c3ccccc3)nc2-c2ccccc2)cc1.
What is the InChIKey of 2,4,5-triphenyltriazole?
The InChIKey is IGCQUFIXBNFPGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)22-23(21-19)18-14-8-3-9-15-18/h1-15H.
What are the key properties of 2,4,5-triphenyltriazole?
2,4,5-triphenyltriazole has a molecular weight of 297.36 g/mol, XLogP of 4.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-triphenyltriazole is sourced from PubChem (CID 561195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).