About benzyl 2-hydroxyacetate
benzyl 2-hydroxyacetate (PubChem CID 561337) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is benzyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | benzyl 2-hydroxyacetate |
| PubChem CID | 561337 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | benzyl 2-hydroxyacetate |
| SMILES | O=C(CO)OCc1ccccc1 |
| InChI | InChI=1S/C9H10O3/c10-6-9(11)12-7-8-4-2-1-3-5-8/h1-5,10H,6-7H2 |
| InChIKey | VPYJBEIOKFRWQZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-hydroxyacetate?
The IUPAC name of benzyl 2-hydroxyacetate (CID 561337) is benzyl 2-hydroxyacetate.
What is the SMILES notation for benzyl 2-hydroxyacetate?
The canonical SMILES for benzyl 2-hydroxyacetate is O=C(CO)OCc1ccccc1.
What is the InChIKey of benzyl 2-hydroxyacetate?
The InChIKey is VPYJBEIOKFRWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c10-6-9(11)12-7-8-4-2-1-3-5-8/h1-5,10H,6-7H2.
What are the key properties of benzyl 2-hydroxyacetate?
benzyl 2-hydroxyacetate has a molecular weight of 166.18 g/mol, XLogP of 0.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-hydroxyacetate is sourced from PubChem (CID 561337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).