C13H8F11NO2 — CID 561513
N-benzyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide (PubChem CID 561513) has the molecular formula C13H8F11NO2 and a molecular weight of 419.19 g/mol. Its IUPAC name is N-benzyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide.
| Compound Name | N-benzyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
|---|---|
| PubChem CID | 561513 |
| Molecular Formula | C13H8F11NO2 |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | N-benzyl-2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanamide |
| SMILES | O=C(NCc1ccccc1)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H8F11NO2/c14-9(11(17,18)19,8(26)25-6-7-4-2-1-3-5-7)27-13(23,24)10(15,16)12(20,21)22/h1-5H,6H2,(H,25,26) |
| InChIKey | MBYGYAYBAZPQOT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|