C21H28O7S — CID 561729
3-(4-methylphenyl)sulfonyloxybutan-2-yl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate (PubChem CID 561729) has the molecular formula C21H28O7S and a molecular weight of 424.52 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyloxybutan-2-yl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate.
| Compound Name | 3-(4-methylphenyl)sulfonyloxybutan-2-yl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
|---|---|
| PubChem CID | 561729 |
| Molecular Formula | C21H28O7S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyloxybutan-2-yl 1,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)C(C)OC(=O)C23CCC(C)(OC2=O)C3(C)C)cc1 |
| InChI | InChI=1S/C21H28O7S/c1-13-7-9-16(10-8-13)29(24,25)28-15(3)14(2)26-17(22)21-12-11-20(6,19(21,4)5)27-18(21)23/h7-10,14-15H,11-12H2,1-6H3 |
| InChIKey | GKOMGKCFMGDMDG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|