About (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate
(3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate (PubChem CID 561888) has the molecular formula C12H18O4S
and a molecular weight of 258.34 g/mol. Its IUPAC name is (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate |
| PubChem CID | 561888 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)(C)CO)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-10-4-6-11(7-5-10)17(14,15)16-9-12(2,3)8-13/h4-7,13H,8-9H2,1-3H3 |
| InChIKey | GLIAEEACYRUJKS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate?
The IUPAC name of (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate (CID 561888) is (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate.
What is the SMILES notation for (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate?
The canonical SMILES for (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(C)(C)CO)cc1.
What is the InChIKey of (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate?
The InChIKey is GLIAEEACYRUJKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4S/c1-10-4-6-11(7-5-10)17(14,15)16-9-12(2,3)8-13/h4-7,13H,8-9H2,1-3H3.
What are the key properties of (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate?
(3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate has a molecular weight of 258.34 g/mol, XLogP of 1.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2,2-dimethylpropyl) 4-methylbenzenesulfonate is sourced from PubChem (CID 561888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).