About 7-butyltricyclo[4.2.2.02,5]dec-7-ene
7-butyltricyclo[4.2.2.02,5]dec-7-ene (PubChem CID 561940) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 7-butyltricyclo[4.2.2.02,5]dec-7-ene.
Molecular Properties
| Compound Name | 7-butyltricyclo[4.2.2.02,5]dec-7-ene |
| PubChem CID | 561940 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 7-butyltricyclo[4.2.2.02,5]dec-7-ene |
| SMILES | CCCCC1=CC2CCC1C1CCC21 |
| InChI | InChI=1S/C14H22/c1-2-3-4-10-9-11-5-6-12(10)14-8-7-13(11)14/h9,11-14H,2-8H2,1H3 |
| InChIKey | RIGCYDPIHFWTCW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-butyltricyclo[4.2.2.02,5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butyltricyclo[4.2.2.02,5]dec-7-ene?
The IUPAC name of 7-butyltricyclo[4.2.2.02,5]dec-7-ene (CID 561940) is 7-butyltricyclo[4.2.2.02,5]dec-7-ene.
What is the SMILES notation for 7-butyltricyclo[4.2.2.02,5]dec-7-ene?
The canonical SMILES for 7-butyltricyclo[4.2.2.02,5]dec-7-ene is CCCCC1=CC2CCC1C1CCC21.
What is the InChIKey of 7-butyltricyclo[4.2.2.02,5]dec-7-ene?
The InChIKey is RIGCYDPIHFWTCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-2-3-4-10-9-11-5-6-12(10)14-8-7-13(11)14/h9,11-14H,2-8H2,1H3.
What are the key properties of 7-butyltricyclo[4.2.2.02,5]dec-7-ene?
7-butyltricyclo[4.2.2.02,5]dec-7-ene has a molecular weight of 190.33 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyltricyclo[4.2.2.02,5]dec-7-ene is sourced from PubChem (CID 561940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).