C23H25NO5 — CID 562033
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole (PubChem CID 562033) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole |
|---|---|
| PubChem CID | 562033 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-phenyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[3,2-d][1,3]oxazole |
| SMILES | CC1(C)OCC(C2OC3OC(c4ccccc4)=NC3C2OCc2ccccc2)O1 |
| InChI | InChI=1S/C23H25NO5/c1-23(2)26-14-17(29-23)19-20(25-13-15-9-5-3-6-10-15)18-22(27-19)28-21(24-18)16-11-7-4-8-12-16/h3-12,17-20,22H,13-14H2,1-2H3 |
| InChIKey | DVJWIAFSQBCWAE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |