About [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate
[3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate (PubChem CID 562071) has the molecular formula C18H25NO7
and a molecular weight of 367.40 g/mol. Its IUPAC name is [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate.
Molecular Properties
| Compound Name | [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate |
| PubChem CID | 562071 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate |
| SMILES | COCC1OC(OC(=O)c2ccccc2)C(NC(C)=O)C(OC)C1OC |
| InChI | InChI=1S/C18H25NO7/c1-11(20)19-14-16(24-4)15(23-3)13(10-22-2)25-18(14)26-17(21)12-8-6-5-7-9-12/h5-9,13-16,18H,10H2,1-4H3,(H,19,20) |
| InChIKey | IDCGYNFFHLZQGX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate?
The IUPAC name of [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate (CID 562071) is [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate.
What is the SMILES notation for [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate?
The canonical SMILES for [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate is COCC1OC(OC(=O)c2ccccc2)C(NC(C)=O)C(OC)C1OC.
What is the InChIKey of [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate?
The InChIKey is IDCGYNFFHLZQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO7/c1-11(20)19-14-16(24-4)15(23-3)13(10-22-2)25-18(14)26-17(21)12-8-6-5-7-9-12/h5-9,13-16,18H,10H2,1-4H3,(H,19,20).
What are the key properties of [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate?
[3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate has a molecular weight of 367.40 g/mol, XLogP of 0.75, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetamido-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl] benzoate is sourced from PubChem (CID 562071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).