About 1,4-diphenylbutan-2-one
1,4-diphenylbutan-2-one (PubChem CID 562082) has the molecular formula C16H16O
and a molecular weight of 224.30 g/mol. Its IUPAC name is 1,4-diphenylbutan-2-one.
Molecular Properties
| Compound Name | 1,4-diphenylbutan-2-one |
| PubChem CID | 562082 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1,4-diphenylbutan-2-one |
| SMILES | O=C(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H16O/c17-16(13-15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | PFJFIFJKDPIALO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-diphenylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diphenylbutan-2-one?
The IUPAC name of 1,4-diphenylbutan-2-one (CID 562082) is 1,4-diphenylbutan-2-one.
What is the SMILES notation for 1,4-diphenylbutan-2-one?
The canonical SMILES for 1,4-diphenylbutan-2-one is O=C(CCc1ccccc1)Cc1ccccc1.
What is the InChIKey of 1,4-diphenylbutan-2-one?
The InChIKey is PFJFIFJKDPIALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O/c17-16(13-15-9-5-2-6-10-15)12-11-14-7-3-1-4-8-14/h1-10H,11-13H2.
What are the key properties of 1,4-diphenylbutan-2-one?
1,4-diphenylbutan-2-one has a molecular weight of 224.30 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diphenylbutan-2-one is sourced from PubChem (CID 562082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).