About ethyl 2-oxo-4-phenylbutanoate
ethyl 2-oxo-4-phenylbutanoate (PubChem CID 562087) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl 2-oxo-4-phenylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-oxo-4-phenylbutanoate |
| PubChem CID | 562087 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethyl 2-oxo-4-phenylbutanoate |
| SMILES | CCOC(=O)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C12H14O3/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3 |
| InChIKey | STPXIOGYOLJXMZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxo-4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxo-4-phenylbutanoate?
The IUPAC name of ethyl 2-oxo-4-phenylbutanoate (CID 562087) is ethyl 2-oxo-4-phenylbutanoate.
What is the SMILES notation for ethyl 2-oxo-4-phenylbutanoate?
The canonical SMILES for ethyl 2-oxo-4-phenylbutanoate is CCOC(=O)C(=O)CCc1ccccc1.
What is the InChIKey of ethyl 2-oxo-4-phenylbutanoate?
The InChIKey is STPXIOGYOLJXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3.
What are the key properties of ethyl 2-oxo-4-phenylbutanoate?
ethyl 2-oxo-4-phenylbutanoate has a molecular weight of 206.24 g/mol, XLogP of 1.75, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo-4-phenylbutanoate is sourced from PubChem (CID 562087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).