C12H16N2S — CID 562154
N-benzyl-3,5-dimethyl-1,3-thiazolidin-2-imine (PubChem CID 562154) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-benzyl-3,5-dimethyl-1,3-thiazolidin-2-imine.
| Compound Name | N-benzyl-3,5-dimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 562154 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-benzyl-3,5-dimethyl-1,3-thiazolidin-2-imine |
| SMILES | CC1CN(C)/C(=N\Cc2ccccc2)S1 |
| InChI | InChI=1S/C12H16N2S/c1-10-9-14(2)12(15-10)13-8-11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3/b13-12+ |
| InChIKey | NUSXZJGKHMLMGW-OUKQBFOZSA-N |
| XLogP | 2.61 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|