About 5-amino-N,1-dibenzyltriazole-4-carboxamide
5-amino-N,1-dibenzyltriazole-4-carboxamide (PubChem CID 562160) has the molecular formula C17H17N5O
and a molecular weight of 307.36 g/mol. Its IUPAC name is 5-amino-N,1-dibenzyltriazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N,1-dibenzyltriazole-4-carboxamide |
| PubChem CID | 562160 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-amino-N,1-dibenzyltriazole-4-carboxamide |
| SMILES | Nc1c(C(=O)NCc2ccccc2)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C17H17N5O/c18-16-15(17(23)19-11-13-7-3-1-4-8-13)20-21-22(16)12-14-9-5-2-6-10-14/h1-10H,11-12,18H2,(H,19,23) |
| InChIKey | GZIMZFHMSLGJTE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-N,1-dibenzyltriazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N,1-dibenzyltriazole-4-carboxamide?
The IUPAC name of 5-amino-N,1-dibenzyltriazole-4-carboxamide (CID 562160) is 5-amino-N,1-dibenzyltriazole-4-carboxamide.
What is the SMILES notation for 5-amino-N,1-dibenzyltriazole-4-carboxamide?
The canonical SMILES for 5-amino-N,1-dibenzyltriazole-4-carboxamide is Nc1c(C(=O)NCc2ccccc2)nnn1Cc1ccccc1.
What is the InChIKey of 5-amino-N,1-dibenzyltriazole-4-carboxamide?
The InChIKey is GZIMZFHMSLGJTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O/c18-16-15(17(23)19-11-13-7-3-1-4-8-13)20-21-22(16)12-14-9-5-2-6-10-14/h1-10H,11-12,18H2,(H,19,23).
What are the key properties of 5-amino-N,1-dibenzyltriazole-4-carboxamide?
5-amino-N,1-dibenzyltriazole-4-carboxamide has a molecular weight of 307.36 g/mol, XLogP of 1.84, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N,1-dibenzyltriazole-4-carboxamide is sourced from PubChem (CID 562160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).