About 3-nitropropylbenzene
3-nitropropylbenzene (PubChem CID 562333) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-nitropropylbenzene.
Molecular Properties
| Compound Name | 3-nitropropylbenzene |
| PubChem CID | 562333 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-nitropropylbenzene |
| SMILES | O=[N+]([O-])CCCc1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | ZROLMSLMPMSLRM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitropropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitropropylbenzene?
The IUPAC name of 3-nitropropylbenzene (CID 562333) is 3-nitropropylbenzene.
What is the SMILES notation for 3-nitropropylbenzene?
The canonical SMILES for 3-nitropropylbenzene is O=[N+]([O-])CCCc1ccccc1.
What is the InChIKey of 3-nitropropylbenzene?
The InChIKey is ZROLMSLMPMSLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2.
What are the key properties of 3-nitropropylbenzene?
3-nitropropylbenzene has a molecular weight of 165.19 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitropropylbenzene is sourced from PubChem (CID 562333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).