About methyl 2-oxo-3-phenylpropanoate
methyl 2-oxo-3-phenylpropanoate (PubChem CID 562359) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is methyl 2-oxo-3-phenylpropanoate.
Molecular Properties
| Compound Name | methyl 2-oxo-3-phenylpropanoate |
| PubChem CID | 562359 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | methyl 2-oxo-3-phenylpropanoate |
| SMILES | COC(=O)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C10H10O3/c1-13-10(12)9(11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | KAOSFPBSWNREAY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxo-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxo-3-phenylpropanoate?
The IUPAC name of methyl 2-oxo-3-phenylpropanoate (CID 562359) is methyl 2-oxo-3-phenylpropanoate.
What is the SMILES notation for methyl 2-oxo-3-phenylpropanoate?
The canonical SMILES for methyl 2-oxo-3-phenylpropanoate is COC(=O)C(=O)Cc1ccccc1.
What is the InChIKey of methyl 2-oxo-3-phenylpropanoate?
The InChIKey is KAOSFPBSWNREAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c1-13-10(12)9(11)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of methyl 2-oxo-3-phenylpropanoate?
methyl 2-oxo-3-phenylpropanoate has a molecular weight of 178.19 g/mol, XLogP of 0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxo-3-phenylpropanoate is sourced from PubChem (CID 562359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).