About 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine
4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine (PubChem CID 562678) has the molecular formula C16H15ClN4O2
and a molecular weight of 330.78 g/mol. Its IUPAC name is 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine.
Molecular Properties
| Compound Name | 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine |
| PubChem CID | 562678 |
| Molecular Formula | C16H15ClN4O2 |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine |
| SMILES | O=[N+]([O-])C1=NN(c2ccc(Cl)cc2)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H15ClN4O2/c17-14-6-8-15(9-7-14)20-12-19(11-16(18-20)21(22)23)10-13-4-2-1-3-5-13/h1-9H,10-12H2 |
| InChIKey | HJXVBZSTTNHXKA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine?
The IUPAC name of 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine (CID 562678) is 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine.
What is the SMILES notation for 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine?
The canonical SMILES for 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine is O=[N+]([O-])C1=NN(c2ccc(Cl)cc2)CN(Cc2ccccc2)C1.
What is the InChIKey of 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine?
The InChIKey is HJXVBZSTTNHXKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN4O2/c17-14-6-8-15(9-7-14)20-12-19(11-16(18-20)21(22)23)10-13-4-2-1-3-5-13/h1-9H,10-12H2.
What are the key properties of 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine?
4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine has a molecular weight of 330.78 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-(4-chlorophenyl)-6-nitro-3,5-dihydro-1,2,4-triazine is sourced from PubChem (CID 562678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).