About N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide
N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide (PubChem CID 562704) has the molecular formula C29H32FNO5
and a molecular weight of 493.58 g/mol. Its IUPAC name is N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide |
| PubChem CID | 562704 |
| Molecular Formula | C29H32FNO5 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(OCc2ccccc2)OC(CF)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H32FNO5/c1-21(32)31-26-28(34-19-23-13-7-3-8-14-23)27(33-18-22-11-5-2-6-12-22)25(17-30)36-29(26)35-20-24-15-9-4-10-16-24/h2-16,25-29H,17-20H2,1H3,(H,31,32) |
| InChIKey | CNENJSGJNDRCHS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide?
The IUPAC name of N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide (CID 562704) is N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide.
What is the SMILES notation for N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide?
The canonical SMILES for N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide is CC(=O)NC1C(OCc2ccccc2)OC(CF)C(OCc2ccccc2)C1OCc1ccccc1.
What is the InChIKey of N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide?
The InChIKey is CNENJSGJNDRCHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32FNO5/c1-21(32)31-26-28(34-19-23-13-7-3-8-14-23)27(33-18-22-11-5-2-6-12-22)25(17-30)36-29(26)35-20-24-15-9-4-10-16-24/h2-16,25-29H,17-20H2,1H3,(H,31,32).
What are the key properties of N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide?
N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide has a molecular weight of 493.58 g/mol, XLogP of 4.57, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide is sourced from PubChem (CID 562704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).