C16H16F7NO3 — CID 562775
propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate (PubChem CID 562775) has the molecular formula C16H16F7NO3 and a molecular weight of 403.29 g/mol. Its IUPAC name is propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate.
| Compound Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 562775 |
| Molecular Formula | C16H16F7NO3 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | propyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoate |
| SMILES | CCCOC(=O)C(Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H16F7NO3/c1-2-8-27-12(25)11(9-10-6-4-3-5-7-10)24-13(26)14(17,18)15(19,20)16(21,22)23/h3-7,11H,2,8-9H2,1H3,(H,24,26) |
| InChIKey | BENJCXJHHRAYLJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|