About 1-bromo-3-hexylbenzene
1-bromo-3-hexylbenzene (PubChem CID 563022) has the molecular formula C12H17Br
and a molecular weight of 241.17 g/mol. Its IUPAC name is 1-bromo-3-hexylbenzene.
Molecular Properties
| Compound Name | 1-bromo-3-hexylbenzene |
| PubChem CID | 563022 |
| Molecular Formula | C12H17Br |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-bromo-3-hexylbenzene |
| SMILES | CCCCCCc1cccc(Br)c1 |
| InChI | InChI=1S/C12H17Br/c1-2-3-4-5-7-11-8-6-9-12(13)10-11/h6,8-10H,2-5,7H2,1H3 |
| InChIKey | HZUVRCRPECDFAT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-hexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-hexylbenzene?
The IUPAC name of 1-bromo-3-hexylbenzene (CID 563022) is 1-bromo-3-hexylbenzene.
What is the SMILES notation for 1-bromo-3-hexylbenzene?
The canonical SMILES for 1-bromo-3-hexylbenzene is CCCCCCc1cccc(Br)c1.
What is the InChIKey of 1-bromo-3-hexylbenzene?
The InChIKey is HZUVRCRPECDFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Br/c1-2-3-4-5-7-11-8-6-9-12(13)10-11/h6,8-10H,2-5,7H2,1H3.
What are the key properties of 1-bromo-3-hexylbenzene?
1-bromo-3-hexylbenzene has a molecular weight of 241.17 g/mol, XLogP of 4.57, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-hexylbenzene is sourced from PubChem (CID 563022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).