C15H21F3O5S — CID 563052
[3-(1-ethoxyethoxy)-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate (PubChem CID 563052) has the molecular formula C15H21F3O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is [3-(1-ethoxyethoxy)-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate.
| Compound Name | [3-(1-ethoxyethoxy)-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 563052 |
| Molecular Formula | C15H21F3O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [3-(1-ethoxyethoxy)-4,4,4-trifluorobutyl] 4-methylbenzenesulfonate |
| SMILES | CCOC(C)OC(CCOS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O5S/c1-4-21-12(3)23-14(15(16,17)18)9-10-22-24(19,20)13-7-5-11(2)6-8-13/h5-8,12,14H,4,9-10H2,1-3H3 |
| InChIKey | WZYSTHVAILUSSN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|