About 1-benzyl-2,5-dimethylpyrrolidine
1-benzyl-2,5-dimethylpyrrolidine (PubChem CID 563059) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-benzyl-2,5-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-benzyl-2,5-dimethylpyrrolidine |
| PubChem CID | 563059 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-benzyl-2,5-dimethylpyrrolidine |
| SMILES | CC1CCC(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H19N/c1-11-8-9-12(2)14(11)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3 |
| InChIKey | KKRNGUFZPFNIFS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-2,5-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,5-dimethylpyrrolidine?
The IUPAC name of 1-benzyl-2,5-dimethylpyrrolidine (CID 563059) is 1-benzyl-2,5-dimethylpyrrolidine.
What is the SMILES notation for 1-benzyl-2,5-dimethylpyrrolidine?
The canonical SMILES for 1-benzyl-2,5-dimethylpyrrolidine is CC1CCC(C)N1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2,5-dimethylpyrrolidine?
The InChIKey is KKRNGUFZPFNIFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-11-8-9-12(2)14(11)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3.
What are the key properties of 1-benzyl-2,5-dimethylpyrrolidine?
1-benzyl-2,5-dimethylpyrrolidine has a molecular weight of 189.30 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,5-dimethylpyrrolidine is sourced from PubChem (CID 563059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).