About 1-benzyltetrazol-5-amine
1-benzyltetrazol-5-amine (PubChem CID 563074) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1-benzyltetrazol-5-amine.
Molecular Properties
| Compound Name | 1-benzyltetrazol-5-amine |
| PubChem CID | 563074 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 1-benzyltetrazol-5-amine |
| SMILES | Nc1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C8H9N5/c9-8-10-11-12-13(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10,12) |
| InChIKey | CGGBUAWMFFPBOD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzyltetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyltetrazol-5-amine?
The IUPAC name of 1-benzyltetrazol-5-amine (CID 563074) is 1-benzyltetrazol-5-amine.
What is the SMILES notation for 1-benzyltetrazol-5-amine?
The canonical SMILES for 1-benzyltetrazol-5-amine is Nc1nnnn1Cc1ccccc1.
What is the InChIKey of 1-benzyltetrazol-5-amine?
The InChIKey is CGGBUAWMFFPBOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c9-8-10-11-12-13(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,9,10,12).
What are the key properties of 1-benzyltetrazol-5-amine?
1-benzyltetrazol-5-amine has a molecular weight of 175.19 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyltetrazol-5-amine is sourced from PubChem (CID 563074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).