C14H19NO — CID 563076
5-benzyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-ol (PubChem CID 563076) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 5-benzyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-ol.
| Compound Name | 5-benzyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-ol |
|---|---|
| PubChem CID | 563076 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 5-benzyl-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[b]pyrrol-6-ol |
| SMILES | OC1C(Cc2ccccc2)CC2CCNC21 |
| InChI | InChI=1S/C14H19NO/c16-14-12(8-10-4-2-1-3-5-10)9-11-6-7-15-13(11)14/h1-5,11-16H,6-9H2 |
| InChIKey | BCDDIELWDUPTGL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |