About benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate
benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 563102) has the molecular formula C21H24N2O4
and a molecular weight of 368.43 g/mol. Its IUPAC name is benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate |
| PubChem CID | 563102 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(NC(=O)C2CC(O)CN2C(=O)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-14-8-9-18(15(2)10-14)22-20(25)19-11-17(24)12-23(19)21(26)27-13-16-6-4-3-5-7-16/h3-10,17,19,24H,11-13H2,1-2H3,(H,22,25) |
| InChIKey | ZGRLGCAHKQDZLR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate?
The IUPAC name of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate (CID 563102) is benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate?
The canonical SMILES for benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate is Cc1ccc(NC(=O)C2CC(O)CN2C(=O)OCc2ccccc2)c(C)c1.
What is the InChIKey of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate?
The InChIKey is ZGRLGCAHKQDZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O4/c1-14-8-9-18(15(2)10-14)22-20(25)19-11-17(24)12-23(19)21(26)27-13-16-6-4-3-5-7-16/h3-10,17,19,24H,11-13H2,1-2H3,(H,22,25).
What are the key properties of benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate?
benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate has a molecular weight of 368.43 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[(2,4-dimethylphenyl)carbamoyl]-4-hydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 563102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).