About benzyl 2-benzylsulfanylacetate
benzyl 2-benzylsulfanylacetate (PubChem CID 563130) has the molecular formula C16H16O2S
and a molecular weight of 272.37 g/mol. Its IUPAC name is benzyl 2-benzylsulfanylacetate.
Molecular Properties
| Compound Name | benzyl 2-benzylsulfanylacetate |
| PubChem CID | 563130 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | benzyl 2-benzylsulfanylacetate |
| SMILES | O=C(CSCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c17-16(18-11-14-7-3-1-4-8-14)13-19-12-15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | ZUOUJUSJZRLCQO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl 2-benzylsulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-benzylsulfanylacetate?
The IUPAC name of benzyl 2-benzylsulfanylacetate (CID 563130) is benzyl 2-benzylsulfanylacetate.
What is the SMILES notation for benzyl 2-benzylsulfanylacetate?
The canonical SMILES for benzyl 2-benzylsulfanylacetate is O=C(CSCc1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl 2-benzylsulfanylacetate?
The InChIKey is ZUOUJUSJZRLCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2S/c17-16(18-11-14-7-3-1-4-8-14)13-19-12-15-9-5-2-6-10-15/h1-10H,11-13H2.
What are the key properties of benzyl 2-benzylsulfanylacetate?
benzyl 2-benzylsulfanylacetate has a molecular weight of 272.37 g/mol, XLogP of 3.66, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-benzylsulfanylacetate is sourced from PubChem (CID 563130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).