About 1-benzyl-4,4-dimethoxypiperidine
1-benzyl-4,4-dimethoxypiperidine (PubChem CID 563186) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-benzyl-4,4-dimethoxypiperidine.
Molecular Properties
| Compound Name | 1-benzyl-4,4-dimethoxypiperidine |
| PubChem CID | 563186 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-benzyl-4,4-dimethoxypiperidine |
| SMILES | COC1(OC)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C14H21NO2/c1-16-14(17-2)8-10-15(11-9-14)12-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3 |
| InChIKey | XKJSCXWZOVORMK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4,4-dimethoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4,4-dimethoxypiperidine?
The IUPAC name of 1-benzyl-4,4-dimethoxypiperidine (CID 563186) is 1-benzyl-4,4-dimethoxypiperidine.
What is the SMILES notation for 1-benzyl-4,4-dimethoxypiperidine?
The canonical SMILES for 1-benzyl-4,4-dimethoxypiperidine is COC1(OC)CCN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-4,4-dimethoxypiperidine?
The InChIKey is XKJSCXWZOVORMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-16-14(17-2)8-10-15(11-9-14)12-13-6-4-3-5-7-13/h3-7H,8-12H2,1-2H3.
What are the key properties of 1-benzyl-4,4-dimethoxypiperidine?
1-benzyl-4,4-dimethoxypiperidine has a molecular weight of 235.33 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,4-dimethoxypiperidine is sourced from PubChem (CID 563186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).