C22H21N3S — CID 563247
N,N-dimethyl-2,3,5-triphenyl-1,3,4-thiadiazol-2-amine (PubChem CID 563247) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is N,N-dimethyl-2,3,5-triphenyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N,N-dimethyl-2,3,5-triphenyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 563247 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N,N-dimethyl-2,3,5-triphenyl-1,3,4-thiadiazol-2-amine |
| SMILES | CN(C)C1(c2ccccc2)SC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C22H21N3S/c1-24(2)22(19-14-8-4-9-15-19)25(20-16-10-5-11-17-20)23-21(26-22)18-12-6-3-7-13-18/h3-17H,1-2H3 |
| InChIKey | MUNJFWNEHZHJLS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |